C22H19Cl2N3O4 — CID 126236564
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide (PubChem CID 126236564) has the molecular formula C22H19Cl2N3O4 and a molecular weight of 460.32 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126236564 |
| Molecular Formula | C22H19Cl2N3O4 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(OCC(=O)N2CCOCC2)cc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H19Cl2N3O4/c23-17-3-6-20(19(24)12-17)26-22(29)16(13-25)11-15-1-4-18(5-2-15)31-14-21(28)27-7-9-30-10-8-27/h1-6,11-12H,7-10,14H2,(H,26,29)/b16-11- |
| InChIKey | CIMIHSIEVSMNRT-WJDWOHSUSA-N |
| XLogP | 3.78 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|