C18H15Cl2N5O2 — CID 75900456
2-cyano-N-(2,5-dichlorophenyl)-3-(2-morpholin-4-ylpyrimidin-5-yl)prop-2-enamide (PubChem CID 75900456) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dichlorophenyl)-3-(2-morpholin-4-ylpyrimidin-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2,5-dichlorophenyl)-3-(2-morpholin-4-ylpyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75900456 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2-cyano-N-(2,5-dichlorophenyl)-3-(2-morpholin-4-ylpyrimidin-5-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1cnc(N2CCOCC2)nc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H15Cl2N5O2/c19-14-1-2-15(20)16(8-14)24-17(26)13(9-21)7-12-10-22-18(23-11-12)25-3-5-27-6-4-25/h1-2,7-8,10-11H,3-6H2,(H,24,26) |
| InChIKey | ZZFCOEZIULGBDU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|