C20H17Cl2N3O2 — CID 18207006
(E)-N-(5-chloro-2-morpholin-4-ylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 18207006) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18207006 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1Cl)C(=O)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c21-16-5-6-19(25-7-9-27-10-8-25)18(12-16)24-20(26)15(13-23)11-14-3-1-2-4-17(14)22/h1-6,11-12H,7-10H2,(H,24,26)/b15-11+ |
| InChIKey | FWADUTGIFFPCPU-RVDMUPIBSA-N |
| XLogP | 4.38 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|