C22H18ClFN6O2 — CID 46518828
(E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide (PubChem CID 46518828) has the molecular formula C22H18ClFN6O2 and a molecular weight of 452.88 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46518828 |
| Molecular Formula | C22H18ClFN6O2 |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-n2cncn2)c(F)c1)C(=O)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H18ClFN6O2/c23-17-2-4-21(29-5-7-32-8-6-29)19(11-17)28-22(31)16(12-25)9-15-1-3-20(18(24)10-15)30-14-26-13-27-30/h1-4,9-11,13-14H,5-8H2,(H,28,31)/b16-9+ |
| InChIKey | DJDLWSASXAFWTF-CXUHLZMHSA-N |
| XLogP | 3.44 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|