C22H22ClN3O3 — CID 9247473
(E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide (PubChem CID 9247473) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9247473 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (E)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide |
| SMILES | C[C@@H]1C[C@@H]1c1ccc(/C=C(\C#N)C(=O)Nc2cc(Cl)ccc2N2CCOCC2)o1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-14-10-18(14)21-5-3-17(29-21)11-15(13-24)22(27)25-19-12-16(23)2-4-20(19)26-6-8-28-9-7-26/h2-5,11-12,14,18H,6-10H2,1H3,(H,25,27)/b15-11+/t14-,18+/m1/s1 |
| InChIKey | HLLDDCFOKJPLGE-NXHOZURCSA-N |
| XLogP | 4.44 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|