C20H20N2O2 — CID 9247297
(E)-2-cyano-N-(2,6-dimethylphenyl)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide (PubChem CID 9247297) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9247297 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C(C#N)=C/c1ccc([C@H]2C[C@H]2C)o1 |
| InChI | InChI=1S/C20H20N2O2/c1-12-5-4-6-13(2)19(12)22-20(23)15(11-21)10-16-7-8-18(24-16)17-9-14(17)3/h4-8,10,14,17H,9H2,1-3H3,(H,22,23)/b15-10+/t14-,17+/m1/s1 |
| InChIKey | BKLILRBQXJYMLT-FIOCRVBZSA-N |
| XLogP | 4.57 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|