C19H15N2O4- — CID 7403746
2-[[(E)-2-cyano-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]benzoate (PubChem CID 7403746) has the molecular formula C19H15N2O4- and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-[[(E)-2-cyano-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | 2-[[(E)-2-cyano-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 7403746 |
| Molecular Formula | C19H15N2O4- |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[[(E)-2-cyano-3-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]prop-2-enoyl]amino]benzoate |
| SMILES | C[C@H]1C[C@H]1c1ccc(/C=C(\C#N)C(=O)Nc2ccccc2C(=O)[O-])o1 |
| InChI | InChI=1S/C19H16N2O4/c1-11-8-15(11)17-7-6-13(25-17)9-12(10-20)18(22)21-16-5-3-2-4-14(16)19(23)24/h2-7,9,11,15H,8H2,1H3,(H,21,22)(H,23,24)/p-1/b12-9+/t11-,15+/m0/s1 |
| InChIKey | MWWRPKZSVLGNLZ-QBAKGOIMSA-M |
| XLogP | 2.31 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|