C20H16Cl2FN3O2 — CID 18275991
(E)-3-(2-chloro-6-fluorophenyl)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyanoprop-2-enamide (PubChem CID 18275991) has the molecular formula C20H16Cl2FN3O2 and a molecular weight of 420.27 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18275991 |
| Molecular Formula | C20H16Cl2FN3O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1c(F)cccc1Cl)C(=O)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H16Cl2FN3O2/c21-14-4-5-19(26-6-8-28-9-7-26)18(11-14)25-20(27)13(12-24)10-15-16(22)2-1-3-17(15)23/h1-5,10-11H,6-9H2,(H,25,27)/b13-10+ |
| InChIKey | BYWZTWFEAHLMOO-JLHYYAGUSA-N |
| XLogP | 4.51 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|