C14H13Cl2N3O2 — CID 108825445
(Z)-2-cyano-N-(2,5-dichlorophenyl)-3-morpholin-4-ylprop-2-enamide (PubChem CID 108825445) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-morpholin-4-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 108825445 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-morpholin-4-ylprop-2-enamide |
| SMILES | N#C/C(=C/N1CCOCC1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O2/c15-11-1-2-12(16)13(7-11)18-14(20)10(8-17)9-19-3-5-21-6-4-19/h1-2,7,9H,3-6H2,(H,18,20)/b10-9- |
| InChIKey | YXRXBGKIJFWUEX-KTKRTIGZSA-N |
| XLogP | 2.67 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|