C15H16ClN3O2 — CID 108839574
(Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-morpholin-4-ylprop-2-enamide (PubChem CID 108839574) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-morpholin-4-ylprop-2-enamide.
| Compound Name | (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 108839574 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-morpholin-4-ylprop-2-enamide |
| SMILES | N#C/C(=C/N1CCOCC1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-14-3-1-12(2-4-14)10-18-15(20)13(9-17)11-19-5-7-21-8-6-19/h1-4,11H,5-8,10H2,(H,18,20)/b13-11- |
| InChIKey | FAUHKJUJQMAPQY-QBFSEMIESA-N |
| XLogP | 1.70 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|