C20H18Cl2N4O3S — CID 108825732
(Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 108825732) has the molecular formula C20H18Cl2N4O3S and a molecular weight of 465.36 g/mol. Its IUPAC name is (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108825732 |
| Molecular Formula | C20H18Cl2N4O3S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | (Z)-3-[4-(benzenesulfonyl)piperazin-1-yl]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(S(=O)(=O)c2ccccc2)CC1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H18Cl2N4O3S/c21-16-6-7-18(22)19(12-16)24-20(27)15(13-23)14-25-8-10-26(11-9-25)30(28,29)17-4-2-1-3-5-17/h1-7,12,14H,8-11H2,(H,24,27)/b15-14- |
| InChIKey | KAZQSHXPXKLQDI-PFONDFGASA-N |
| XLogP | 3.35 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|