C18H19Cl2N3O3 — CID 108825411
ethyl 1-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperidine-4-carboxylate (PubChem CID 108825411) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is ethyl 1-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108825411 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | ethyl 1-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C=C(/C#N)C(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-2-26-18(25)12-5-7-23(8-6-12)11-13(10-21)17(24)22-16-9-14(19)3-4-15(16)20/h3-4,9,11-12H,2,5-8H2,1H3,(H,22,24)/b13-11- |
| InChIKey | LFZPQTWHYMGEJJ-QBFSEMIESA-N |
| XLogP | 3.61 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|