C18H20ClN3O3 — CID 22695890
ethyl 1-[(E)-3-(3-chloroanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylate (PubChem CID 22695890) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is ethyl 1-[(E)-3-(3-chloroanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(E)-3-(3-chloroanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22695890 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | ethyl 1-[(E)-3-(3-chloroanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C=C(\C#N)C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-2-25-18(24)13-6-8-22(9-7-13)12-14(11-20)17(23)21-16-5-3-4-15(19)10-16/h3-5,10,12-13H,2,6-9H2,1H3,(H,21,23)/b14-12+ |
| InChIKey | IGCRDJLTOOOOJE-WYMLVPIESA-N |
| XLogP | 2.96 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|