C19H22ClN3O3 — CID 108850047
ethyl 1-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-3-carboxylate (PubChem CID 108850047) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is ethyl 1-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108850047 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | ethyl 1-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C=C(/C#N)C(=O)Nc2cc(Cl)ccc2C)C1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-3-26-19(25)14-5-4-8-23(11-14)12-15(10-21)18(24)22-17-9-16(20)7-6-13(17)2/h6-7,9,12,14H,3-5,8,11H2,1-2H3,(H,22,24)/b15-12- |
| InChIKey | BXYKQHZWZVHIHJ-QINSGFPZSA-N |
| XLogP | 3.27 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|