C14H19N3O5 — CID 108844079
2-[[(Z)-2-cyano-3-(3-ethoxycarbonylpiperidin-1-yl)prop-2-enoyl]amino]acetic acid (PubChem CID 108844079) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(3-ethoxycarbonylpiperidin-1-yl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(3-ethoxycarbonylpiperidin-1-yl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 108844079 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(3-ethoxycarbonylpiperidin-1-yl)prop-2-enoyl]amino]acetic acid |
| SMILES | CCOC(=O)C1CCCN(/C=C(/C#N)C(=O)NCC(=O)O)C1 |
| InChI | InChI=1S/C14H19N3O5/c1-2-22-14(21)10-4-3-5-17(8-10)9-11(6-15)13(20)16-7-12(18)19/h9-10H,2-5,7-8H2,1H3,(H,16,20)(H,18,19)/b11-9- |
| InChIKey | JJIBNEZAWOZCGI-LUAWRHEFSA-N |
| XLogP | -0.13 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|