C12H17N3O4 — CID 43316014
ethyl 1-[2-(cyanomethylamino)-2-oxoacetyl]piperidine-3-carboxylate (PubChem CID 43316014) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 1-[2-(cyanomethylamino)-2-oxoacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(cyanomethylamino)-2-oxoacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43316014 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | ethyl 1-[2-(cyanomethylamino)-2-oxoacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(=O)NCC#N)C1 |
| InChI | InChI=1S/C12H17N3O4/c1-2-19-12(18)9-4-3-7-15(8-9)11(17)10(16)14-6-5-13/h9H,2-4,6-8H2,1H3,(H,14,16) |
| InChIKey | JEWQFIRKIPOVBN-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|