C11H16N4O3 — CID 103195511
1-[2-(cyanomethylamino)-2-oxoacetyl]-N-methylpiperidine-3-carboxamide (PubChem CID 103195511) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-[2-(cyanomethylamino)-2-oxoacetyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[2-(cyanomethylamino)-2-oxoacetyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103195511 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-[2-(cyanomethylamino)-2-oxoacetyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(C(=O)C(=O)NCC#N)C1 |
| InChI | InChI=1S/C11H16N4O3/c1-13-9(16)8-3-2-6-15(7-8)11(18)10(17)14-5-4-12/h8H,2-3,5-7H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | PXTSKYIDNUJIMQ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|