C14H25N3O4 — CID 108521928
ethyl 1-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperidine-3-carboxylate (PubChem CID 108521928) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 1-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108521928 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | ethyl 1-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(=O)NCCN(C)C)C1 |
| InChI | InChI=1S/C14H25N3O4/c1-4-21-14(20)11-6-5-8-17(10-11)13(19)12(18)15-7-9-16(2)3/h11H,4-10H2,1-3H3,(H,15,18) |
| InChIKey | GPOUQEHRDYCUIU-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|