C17H18Cl2N4O3 — CID 108825682
ethyl 4-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108825682) has the molecular formula C17H18Cl2N4O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is ethyl 4-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108825682 |
| Molecular Formula | C17H18Cl2N4O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | ethyl 4-[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H18Cl2N4O3/c1-2-26-17(25)23-7-5-22(6-8-23)11-12(10-20)16(24)21-15-9-13(18)3-4-14(15)19/h3-4,9,11H,2,5-8H2,1H3,(H,21,24)/b12-11- |
| InChIKey | WNFKRGJWPYYGCO-QXMHVHEDSA-N |
| XLogP | 3.11 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|