C21H18ClF2N3O3 — CID 74274310
N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 74274310) has the molecular formula C21H18ClF2N3O3 and a molecular weight of 433.84 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 74274310 |
| Molecular Formula | C21H18ClF2N3O3 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OC(F)F)C(=O)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H18ClF2N3O3/c22-16-5-6-18(27-7-9-29-10-8-27)17(12-16)26-20(28)15(13-25)11-14-3-1-2-4-19(14)30-21(23)24/h1-6,11-12,21H,7-10H2,(H,26,28) |
| InChIKey | QNDPNAZNKKNGNC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|