C19H15ClF2N2O3 — CID 3654174
N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 3654174) has the molecular formula C19H15ClF2N2O3 and a molecular weight of 392.79 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3654174 |
| Molecular Formula | C19H15ClF2N2O3 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(C#N)=Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H15ClF2N2O3/c1-11-7-15(17(26-2)9-14(11)20)24-18(25)13(10-23)8-12-5-3-4-6-16(12)27-19(21)22/h3-9,19H,1-2H3,(H,24,25) |
| InChIKey | HHISRNZNVIRFPF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|