C20H17ClN2O4 — CID 7515710
methyl 4-[(E)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-3-oxoprop-1-enyl]benzoate (PubChem CID 7515710) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is methyl 4-[(E)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 7515710 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | methyl 4-[(E)-3-(4-chloro-2-methoxy-5-methylanilino)-2-cyano-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\C#N)C(=O)Nc2cc(C)c(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C20H17ClN2O4/c1-12-8-17(18(26-2)10-16(12)21)23-19(24)15(11-22)9-13-4-6-14(7-5-13)20(25)27-3/h4-10H,1-3H3,(H,23,24)/b15-9+ |
| InChIKey | RFIWAVQMZCTSNQ-OQLLNIDSSA-N |
| XLogP | 3.99 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|