C19H14ClN3O2S — CID 132968542
(Z)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-thieno[3,2-b]pyridin-6-ylprop-2-enamide (PubChem CID 132968542) has the molecular formula C19H14ClN3O2S and a molecular weight of 383.86 g/mol. Its IUPAC name is (Z)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-thieno[3,2-b]pyridin-6-ylprop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-thieno[3,2-b]pyridin-6-ylprop-2-enamide |
|---|---|
| PubChem CID | 132968542 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (Z)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-thieno[3,2-b]pyridin-6-ylprop-2-enamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)/C(C#N)=C\c1cnc2ccsc2c1 |
| InChI | InChI=1S/C19H14ClN3O2S/c1-11-5-16(17(25-2)8-14(11)20)23-19(24)13(9-21)6-12-7-18-15(22-10-12)3-4-26-18/h3-8,10H,1-2H3,(H,23,24)/b13-6- |
| InChIKey | WJLTYARMWSMABD-MLPAPPSSSA-N |
| XLogP | 4.81 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|