C22H18Cl2N4O2 — CID 24542415
(E)-N-(4-chloro-2-methoxy-5-methylphenyl)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 24542415) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 24542415 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)/C(C#N)=C/c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-14-7-20(21(30-2)9-19(14)24)27-22(29)17(10-25)8-15-11-26-28(12-15)13-16-5-3-4-6-18(16)23/h3-9,11-12H,13H2,1-2H3,(H,27,29)/b17-8+ |
| InChIKey | ORNVJOQMAFFRIJ-CAOOACKPSA-N |
| XLogP | 5.10 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|