C22H19ClN4O — CID 24542427
(E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 24542427) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24542427 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)/C(C#N)=C/c2cnn(Cc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN4O/c1-2-16-7-9-20(10-8-16)26-22(28)19(12-24)11-17-13-25-27(14-17)15-18-5-3-4-6-21(18)23/h3-11,13-14H,2,15H2,1H3,(H,26,28)/b19-11+ |
| InChIKey | NDNZIDSHBSNISO-YBFXNURJSA-N |
| XLogP | 4.69 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|