C14H11ClN4O — CID 24542355
(E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 24542355) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 24542355 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cnn(Cc2ccccc2Cl)c1)C(N)=O |
| InChI | InChI=1S/C14H11ClN4O/c15-13-4-2-1-3-11(13)9-19-8-10(7-18-19)5-12(6-16)14(17)20/h1-5,7-8H,9H2,(H2,17,20)/b12-5+ |
| InChIKey | DZGMVRDCQFHZRF-LFYBBSHMSA-N |
| XLogP | 1.98 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|