C21H16ClN3O3 — CID 34903705
(E)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide (PubChem CID 34903705) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 34903705 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-cyano-3-(2-oxo-1H-quinolin-3-yl)prop-2-enamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)/C(C#N)=C/c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C21H16ClN3O3/c1-12-7-18(19(28-2)10-16(12)22)25-21(27)15(11-23)9-14-8-13-5-3-4-6-17(13)24-20(14)26/h3-10H,1-2H3,(H,24,26)(H,25,27)/b15-9+ |
| InChIKey | BKQYZKCRELQOJY-OQLLNIDSSA-N |
| XLogP | 4.04 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|