C22H18F5N3O3 — CID 167794576
(E)-2-cyano-3-[2-(difluoromethoxy)phenyl]-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 167794576) has the molecular formula C22H18F5N3O3 and a molecular weight of 467.39 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(difluoromethoxy)phenyl]-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(difluoromethoxy)phenyl]-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167794576 |
| Molecular Formula | C22H18F5N3O3 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (E)-2-cyano-3-[2-(difluoromethoxy)phenyl]-N-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1OC(F)F)C(=O)Nc1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H18F5N3O3/c23-21(24)33-19-4-2-1-3-14(19)11-15(13-28)20(31)29-18-6-5-16(12-17(18)22(25,26)27)30-7-9-32-10-8-30/h1-6,11-12,21H,7-10H2,(H,29,31)/b15-11+ |
| InChIKey | ZNRVSYLTWRSCSQ-RVDMUPIBSA-N |
| XLogP | 4.69 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|