C20H15F3N2O2 — CID 27103075
(E)-2-cyano-3-(2-prop-2-enoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 27103075) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-prop-2-enoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-prop-2-enoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 27103075 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (E)-2-cyano-3-(2-prop-2-enoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CCOc1ccccc1/C=C(\C#N)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O2/c1-2-11-27-18-10-6-3-7-14(18)12-15(13-24)19(26)25-17-9-5-4-8-16(17)20(21,22)23/h2-10,12H,1,11H2,(H,25,26)/b15-12+ |
| InChIKey | HFQPLJJRFXJHTI-NTCAYCPXSA-N |
| XLogP | 4.82 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|