C19H13F3N2O4 — CID 6307896
2-[4-[(E)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]acetic acid (PubChem CID 6307896) has the molecular formula C19H13F3N2O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6307896 |
| Molecular Formula | C19H13F3N2O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-oxo-3-[2-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C\c1ccc(OCC(=O)O)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H13F3N2O4/c20-19(21,22)15-3-1-2-4-16(15)24-18(27)13(10-23)9-12-5-7-14(8-6-12)28-11-17(25)26/h1-9H,11H2,(H,24,27)(H,25,26)/b13-9+ |
| InChIKey | YCIDLIFGPDMOLJ-UKTHLTGXSA-N |
| XLogP | 3.71 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|