C22H16F3N3O2S — CID 24505513
(E)-2-cyano-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 24505513) has the molecular formula C22H16F3N3O2S and a molecular weight of 443.45 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24505513 |
| Molecular Formula | C22H16F3N3O2S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (E)-2-cyano-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(/C=C(\C#N)C(=O)Nc3ccccc3C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C22H16F3N3O2S/c1-14-27-17(13-31-14)12-30-18-8-6-15(7-9-18)10-16(11-26)21(29)28-20-5-3-2-4-19(20)22(23,24)25/h2-10,13H,12H2,1H3,(H,28,29)/b16-10+ |
| InChIKey | HDXHBAJNGFRJIQ-MHWRWJLKSA-N |
| XLogP | 5.59 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|