C15H8BrF3N2OS — CID 55578568
(E)-3-(5-bromothiophen-3-yl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 55578568) has the molecular formula C15H8BrF3N2OS and a molecular weight of 401.21 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-3-yl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-3-yl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55578568 |
| Molecular Formula | C15H8BrF3N2OS |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | (E)-3-(5-bromothiophen-3-yl)-2-cyano-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1csc(Br)c1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H8BrF3N2OS/c16-13-6-9(8-23-13)5-10(7-20)14(22)21-12-4-2-1-3-11(12)15(17,18)19/h1-6,8H,(H,21,22)/b10-5+ |
| InChIKey | ZXZLLNYVSMRVDS-BJMVGYQFSA-N |
| XLogP | 5.08 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|