C16H11F3N2OS — CID 958228
(E)-2-cyano-3-(3-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 958228) has the molecular formula C16H11F3N2OS and a molecular weight of 336.34 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 958228 |
| Molecular Formula | C16H11F3N2OS |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (E)-2-cyano-3-(3-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccsc1/C=C(\C#N)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H11F3N2OS/c1-10-6-7-23-14(10)8-11(9-20)15(22)21-13-5-3-2-4-12(13)16(17,18)19/h2-8H,1H3,(H,21,22)/b11-8+ |
| InChIKey | ORSDWGXQAWKFIN-DHZHZOJOSA-N |
| XLogP | 4.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|