C24H27F2N3O4 — CID 16598411
(E)-3-[2-(difluoromethoxy)phenyl]-N-(2,4-dimorpholin-4-ylphenyl)prop-2-enamide (PubChem CID 16598411) has the molecular formula C24H27F2N3O4 and a molecular weight of 459.49 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,4-dimorpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,4-dimorpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16598411 |
| Molecular Formula | C24H27F2N3O4 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2,4-dimorpholin-4-ylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C24H27F2N3O4/c25-24(26)33-22-4-2-1-3-18(22)5-8-23(30)27-20-7-6-19(28-9-13-31-14-10-28)17-21(20)29-11-15-32-16-12-29/h1-8,17,24H,9-16H2,(H,27,30)/b8-5+ |
| InChIKey | RWHFMRNCNSUCTR-VMPITWQZSA-N |
| XLogP | 3.61 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|