C16H11Br2F2NO2 — CID 16591585
(E)-N-(2,4-dibromophenyl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 16591585) has the molecular formula C16H11Br2F2NO2 and a molecular weight of 447.07 g/mol. Its IUPAC name is (E)-N-(2,4-dibromophenyl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,4-dibromophenyl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16591585 |
| Molecular Formula | C16H11Br2F2NO2 |
| Molecular Weight | 447.07 g/mol |
| Exact Mass | 444.91 |
| IUPAC Name | (E)-N-(2,4-dibromophenyl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br2F2NO2/c17-11-6-7-13(12(18)9-11)21-15(22)8-5-10-3-1-2-4-14(10)23-16(19)20/h1-9,16H,(H,21,22)/b8-5+ |
| InChIKey | AOHAUSAFPASGDS-VMPITWQZSA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.07 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|