C19H19BrFNO2 — CID 53267575
(E)-N-(4-bromo-2-fluorophenyl)-3-(2-butoxyphenyl)prop-2-enamide (PubChem CID 53267575) has the molecular formula C19H19BrFNO2 and a molecular weight of 392.27 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-fluorophenyl)-3-(2-butoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(2-butoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267575 |
| Molecular Formula | C19H19BrFNO2 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(2-butoxyphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccccc1/C=C/C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C19H19BrFNO2/c1-2-3-12-24-18-7-5-4-6-14(18)8-11-19(23)22-17-10-9-15(20)13-16(17)21/h4-11,13H,2-3,12H2,1H3,(H,22,23)/b11-8+ |
| InChIKey | HOEWRRGOZAKWDU-DHZHZOJOSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|