C17H15BrFNO3 — CID 2111077
(E)-N-(4-bromo-2-fluorophenyl)-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 2111077) has the molecular formula C17H15BrFNO3 and a molecular weight of 380.21 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-fluorophenyl)-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2111077 |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(Br)cc2F)c1OC |
| InChI | InChI=1S/C17H15BrFNO3/c1-22-15-5-3-4-11(17(15)23-2)6-9-16(21)20-14-8-7-12(18)10-13(14)19/h3-10H,1-2H3,(H,20,21)/b9-6+ |
| InChIKey | YNAGAHUNTCXAOI-RMKNXTFCSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|