C23H21NO3 — CID 2431859
(E)-3-(2,3-dimethoxyphenyl)-N-(2-phenylphenyl)prop-2-enamide (PubChem CID 2431859) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N-(2-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N-(2-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2431859 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N-(2-phenylphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccccc2-c2ccccc2)c1OC |
| InChI | InChI=1S/C23H21NO3/c1-26-21-14-8-11-18(23(21)27-2)15-16-22(25)24-20-13-7-6-12-19(20)17-9-4-3-5-10-17/h3-16H,1-2H3,(H,24,25)/b16-15+ |
| InChIKey | PBJJWQFUKHMUQV-FOCLMDBBSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|