C24H23NO4 — CID 7929957
(E)-N-(2-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 7929957) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is (E)-N-(2-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7929957 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (E)-N-(2-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO4/c1-27-21-15-17(16-22(28-2)24(21)29-3)13-14-23(26)25-20-12-8-7-11-19(20)18-9-5-4-6-10-18/h4-16H,1-3H3,(H,25,26)/b14-13+ |
| InChIKey | RQFSDTJEPCZZFC-BUHFOSPRSA-N |
| XLogP | 5.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|