C23H25FN2O5 — CID 154637698
methyl 4-acetamido-2-butoxy-5-[3-(2-fluorophenyl)prop-2-enoylamino]benzoate (PubChem CID 154637698) has the molecular formula C23H25FN2O5 and a molecular weight of 428.46 g/mol. Its IUPAC name is methyl 4-acetamido-2-butoxy-5-[3-(2-fluorophenyl)prop-2-enoylamino]benzoate.
| Compound Name | methyl 4-acetamido-2-butoxy-5-[3-(2-fluorophenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 154637698 |
| Molecular Formula | C23H25FN2O5 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | methyl 4-acetamido-2-butoxy-5-[3-(2-fluorophenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCCOc1cc(NC(C)=O)c(NC(=O)C=Cc2ccccc2F)cc1C(=O)OC |
| InChI | InChI=1S/C23H25FN2O5/c1-4-5-12-31-21-14-20(25-15(2)27)19(13-17(21)23(29)30-3)26-22(28)11-10-16-8-6-7-9-18(16)24/h6-11,13-14H,4-5,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | NCIXPTQCTKXTJL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|