C15H11BrFNO3 — CID 17202089
N-(4-bromo-2-fluorophenyl)-2-(2-formylphenoxy)acetamide (PubChem CID 17202089) has the molecular formula C15H11BrFNO3 and a molecular weight of 352.16 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-(2-formylphenoxy)acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-(2-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 17202089 |
| Molecular Formula | C15H11BrFNO3 |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-(2-formylphenoxy)acetamide |
| SMILES | O=Cc1ccccc1OCC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H11BrFNO3/c16-11-5-6-13(12(17)7-11)18-15(20)9-21-14-4-2-1-3-10(14)8-19/h1-8H,9H2,(H,18,20) |
| InChIKey | ATLBOKIJDQIFOM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|