C14H9Br2F2NO2 — CID 2632796
2-(2,4-dibromophenoxy)-N-(2,4-difluorophenyl)acetamide (PubChem CID 2632796) has the molecular formula C14H9Br2F2NO2 and a molecular weight of 421.04 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2632796 |
| Molecular Formula | C14H9Br2F2NO2 |
| Molecular Weight | 421.04 g/mol |
| Exact Mass | 418.90 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9Br2F2NO2/c15-8-1-4-13(10(16)5-8)21-7-14(20)19-12-3-2-9(17)6-11(12)18/h1-6H,7H2,(H,19,20) |
| InChIKey | IBMZPBCQNVOHTK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |