C18H14BrF2NO4 — CID 16597702
(E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 16597702) has the molecular formula C18H14BrF2NO4 and a molecular weight of 426.21 g/mol. Its IUPAC name is (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16597702 |
| Molecular Formula | C18H14BrF2NO4 |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C18H14BrF2NO4/c19-12-9-15-16(25-8-7-24-15)10-13(12)22-17(23)6-5-11-3-1-2-4-14(11)26-18(20)21/h1-6,9-10,18H,7-8H2,(H,22,23)/b6-5+ |
| InChIKey | KAORBOUFNSYKJO-AATRIKPKSA-N |
| XLogP | 4.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|