C19H17F2NO4 — CID 55727691
3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 55727691) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55727691 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | CC1(C)Oc2ccc(NC(=O)C=Cc3ccccc3OC(F)F)cc2O1 |
| InChI | InChI=1S/C19H17F2NO4/c1-19(2)25-15-9-8-13(11-16(15)26-19)22-17(23)10-7-12-5-3-4-6-14(12)24-18(20)21/h3-11,18H,1-2H3,(H,22,23) |
| InChIKey | GWQFYLWOWAPBOC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|