C19H13F5N2O3 — CID 55710955
N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 55710955) has the molecular formula C19H13F5N2O3 and a molecular weight of 412.31 g/mol. Its IUPAC name is N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55710955 |
| Molecular Formula | C19H13F5N2O3 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | N#Cc1cc(NC(=O)C=Cc2ccccc2OC(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C19H13F5N2O3/c20-18(21)29-16-4-2-1-3-12(16)5-8-17(27)26-14-6-7-15(13(9-14)10-25)28-11-19(22,23)24/h1-9,18H,11H2,(H,26,27) |
| InChIKey | KTQZUBJPWRMMBD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|