C20H18F2N2O3 — CID 24601687
N-[4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 24601687) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is N-[4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 24601687 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H18F2N2O3/c21-20(22)27-17-4-2-1-3-13(17)7-12-18(25)23-15-8-10-16(11-9-15)24-19(26)14-5-6-14/h1-4,7-12,14,20H,5-6H2,(H,23,25)(H,24,26)/b12-7+ |
| InChIKey | FJRADPACARZBNI-KPKJPENVSA-N |
| XLogP | 4.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|