C17H16F2N2O4S — CID 134019456
(E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(sulfamoylmethyl)phenyl]prop-2-enamide (PubChem CID 134019456) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(sulfamoylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(sulfamoylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134019456 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(sulfamoylmethyl)phenyl]prop-2-enamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)/C=C/c2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C17H16F2N2O4S/c18-17(19)25-15-4-2-1-3-13(15)7-10-16(22)21-14-8-5-12(6-9-14)11-26(20,23)24/h1-10,17H,11H2,(H,21,22)(H2,20,23,24)/b10-7+ |
| InChIKey | IGZOHIVYFVKDFU-JXMROGBWSA-N |
| XLogP | 2.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|