C15H14F2N2O4S — CID 39977055
2-(difluoromethoxy)-N-[4-(sulfamoylmethyl)phenyl]benzamide (PubChem CID 39977055) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[4-(sulfamoylmethyl)phenyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[4-(sulfamoylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 39977055 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-(difluoromethoxy)-N-[4-(sulfamoylmethyl)phenyl]benzamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)c2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C15H14F2N2O4S/c16-15(17)23-13-4-2-1-3-12(13)14(20)19-11-7-5-10(6-8-11)9-24(18,21)22/h1-8,15H,9H2,(H,19,20)(H2,18,21,22) |
| InChIKey | LHEPJVUKMMTWQX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |