C19H20F2N2O4S — CID 24612653
(E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 24612653) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24612653 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)Cc1ccccc1CNC(=O)/C=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O4S/c1-22-28(25,26)13-16-8-3-2-7-15(16)12-23-18(24)11-10-14-6-4-5-9-17(14)27-19(20)21/h2-11,19,22H,12-13H2,1H3,(H,23,24)/b11-10+ |
| InChIKey | CSCARVVZLCLWDM-ZHACJKMWSA-N |
| XLogP | 2.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|