C19H20F2N2O2 — CID 26130489
(E)-3-[2-(difluoromethoxy)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]prop-2-enamide (PubChem CID 26130489) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 26130489 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[4-(dimethylamino)phenyl]methyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(CNC(=O)/C=C/c2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C19H20F2N2O2/c1-23(2)16-10-7-14(8-11-16)13-22-18(24)12-9-15-5-3-4-6-17(15)25-19(20)21/h3-12,19H,13H2,1-2H3,(H,22,24)/b12-9+ |
| InChIKey | XORFTZSBYQCEQH-FMIVXFBMSA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|